About 1-(3-methyl-1,2-oxazol-4-yl)ethanol
1-(3-methyl-1,2-oxazol-4-yl)ethanol (PubChem CID 122163695) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is 1-(3-methyl-1,2-oxazol-4-yl)ethanol.
Molecular Properties
| Compound Name | 1-(3-methyl-1,2-oxazol-4-yl)ethanol |
| PubChem CID | 122163695 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 1-(3-methyl-1,2-oxazol-4-yl)ethanol |
| SMILES | Cc1nocc1C(C)O |
| InChI | InChI=1S/C6H9NO2/c1-4-6(5(2)8)3-9-7-4/h3,5,8H,1-2H3 |
| InChIKey | OXCKTORPCDMSFF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-methyl-1,2-oxazol-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methyl-1,2-oxazol-4-yl)ethanol?
The IUPAC name of 1-(3-methyl-1,2-oxazol-4-yl)ethanol (CID 122163695) is 1-(3-methyl-1,2-oxazol-4-yl)ethanol.
What is the SMILES notation for 1-(3-methyl-1,2-oxazol-4-yl)ethanol?
The canonical SMILES for 1-(3-methyl-1,2-oxazol-4-yl)ethanol is Cc1nocc1C(C)O.
What is the InChIKey of 1-(3-methyl-1,2-oxazol-4-yl)ethanol?
The InChIKey is OXCKTORPCDMSFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c1-4-6(5(2)8)3-9-7-4/h3,5,8H,1-2H3.
What are the key properties of 1-(3-methyl-1,2-oxazol-4-yl)ethanol?
1-(3-methyl-1,2-oxazol-4-yl)ethanol has a molecular weight of 127.14 g/mol, XLogP of 1.04, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methyl-1,2-oxazol-4-yl)ethanol is sourced from PubChem (CID 122163695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).