About N'-methoxy-N'-methylpropane-1,3-diamine;dihydrochloride
N'-methoxy-N'-methylpropane-1,3-diamine;dihydrochloride (PubChem CID 122163888) has the molecular formula C5H16Cl2N2O
and a molecular weight of 191.10 g/mol. Its IUPAC name is N'-methoxy-N'-methylpropane-1,3-diamine;dihydrochloride.
Molecular Properties
| Compound Name | N'-methoxy-N'-methylpropane-1,3-diamine;dihydrochloride |
| PubChem CID | 122163888 |
| Molecular Formula | C5H16Cl2N2O |
| Molecular Weight | 191.10 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | N'-methoxy-N'-methylpropane-1,3-diamine;dihydrochloride |
| SMILES | CON(C)CCCN.Cl.Cl |
| InChI | InChI=1S/C5H14N2O.2ClH/c1-7(8-2)5-3-4-6;;/h3-6H2,1-2H3;2*1H |
| InChIKey | CBRXWJWTCYSLGU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.10 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-methoxy-N'-methylpropane-1,3-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methoxy-N'-methylpropane-1,3-diamine;dihydrochloride?
The IUPAC name of N'-methoxy-N'-methylpropane-1,3-diamine;dihydrochloride (CID 122163888) is N'-methoxy-N'-methylpropane-1,3-diamine;dihydrochloride.
What is the SMILES notation for N'-methoxy-N'-methylpropane-1,3-diamine;dihydrochloride?
The canonical SMILES for N'-methoxy-N'-methylpropane-1,3-diamine;dihydrochloride is CON(C)CCCN.Cl.Cl.
What is the InChIKey of N'-methoxy-N'-methylpropane-1,3-diamine;dihydrochloride?
The InChIKey is CBRXWJWTCYSLGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N2O.2ClH/c1-7(8-2)5-3-4-6;;/h3-6H2,1-2H3;2*1H.
What are the key properties of N'-methoxy-N'-methylpropane-1,3-diamine;dihydrochloride?
N'-methoxy-N'-methylpropane-1,3-diamine;dihydrochloride has a molecular weight of 191.10 g/mol, XLogP of 0.67, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methoxy-N'-methylpropane-1,3-diamine;dihydrochloride is sourced from PubChem (CID 122163888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).