About 1-methyl-1,3-diazinan-2-one;hydrochloride
1-methyl-1,3-diazinan-2-one;hydrochloride (PubChem CID 122163940) has the molecular formula C5H11ClN2O
and a molecular weight of 150.61 g/mol. Its IUPAC name is 1-methyl-1,3-diazinan-2-one;hydrochloride.
Molecular Properties
| Compound Name | 1-methyl-1,3-diazinan-2-one;hydrochloride |
| PubChem CID | 122163940 |
| Molecular Formula | C5H11ClN2O |
| Molecular Weight | 150.61 g/mol |
| Exact Mass | 150.06 |
| IUPAC Name | 1-methyl-1,3-diazinan-2-one;hydrochloride |
| SMILES | CN1CCCNC1=O.Cl |
| InChI | InChI=1S/C5H10N2O.ClH/c1-7-4-2-3-6-5(7)8;/h2-4H2,1H3,(H,6,8);1H |
| InChIKey | HDGQTYSLJDXVKY-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.61 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-1,3-diazinan-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1,3-diazinan-2-one;hydrochloride?
The IUPAC name of 1-methyl-1,3-diazinan-2-one;hydrochloride (CID 122163940) is 1-methyl-1,3-diazinan-2-one;hydrochloride.
What is the SMILES notation for 1-methyl-1,3-diazinan-2-one;hydrochloride?
The canonical SMILES for 1-methyl-1,3-diazinan-2-one;hydrochloride is CN1CCCNC1=O.Cl.
What is the InChIKey of 1-methyl-1,3-diazinan-2-one;hydrochloride?
The InChIKey is HDGQTYSLJDXVKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O.ClH/c1-7-4-2-3-6-5(7)8;/h2-4H2,1H3,(H,6,8);1H.
What are the key properties of 1-methyl-1,3-diazinan-2-one;hydrochloride?
1-methyl-1,3-diazinan-2-one;hydrochloride has a molecular weight of 150.61 g/mol, XLogP of 0.45, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1,3-diazinan-2-one;hydrochloride is sourced from PubChem (CID 122163940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).