methyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoate

C7H10N2O3 — CID 122164085

IUPACmethyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoate
SMILESCOC(=O)CCc1nnc(C)o1
InChIInChI=1S/C7H10N2O3/c1-5-8-9-6(12-5)3-4-7(10)11-2/h3-4H2,1-2H3
InChIKeyREFOMIINHFWSLA-UHFFFAOYSA-N
MW170.17 g/mol
LogP0.48
Rot. Bonds3

About methyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoate

methyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoate (PubChem CID 122164085) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is methyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoate.

Molecular Properties

Compound Namemethyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoate
PubChem CID122164085
Molecular FormulaC7H10N2O3
Molecular Weight170.17 g/mol
Exact Mass170.07
IUPAC Namemethyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoate
SMILESCOC(=O)CCc1nnc(C)o1
InChIInChI=1S/C7H10N2O3/c1-5-8-9-6(12-5)3-4-7(10)11-2/h3-4H2,1-2H3
InChIKeyREFOMIINHFWSLA-UHFFFAOYSA-N
XLogP0.48
TPSA65.22 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.17
LogP ≤ 50.48
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoate?
The IUPAC name of methyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoate (CID 122164085) is methyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoate.
What is the SMILES notation for methyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoate?
The canonical SMILES for methyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoate is COC(=O)CCc1nnc(C)o1.
What is the InChIKey of methyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoate?
The InChIKey is REFOMIINHFWSLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-5-8-9-6(12-5)3-4-7(10)11-2/h3-4H2,1-2H3.
What are the key properties of methyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoate?
methyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoate has a molecular weight of 170.17 g/mol, XLogP of 0.48, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoate is sourced from PubChem (CID 122164085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).