About tert-butyl (3S,5S)-3-amino-5-fluoropiperidine-1-carboxylate
tert-butyl (3S,5S)-3-amino-5-fluoropiperidine-1-carboxylate (PubChem CID 122164103) has the molecular formula C10H19FN2O2
and a molecular weight of 218.27 g/mol. Its IUPAC name is tert-butyl (3S,5S)-3-amino-5-fluoropiperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (3S,5S)-3-amino-5-fluoropiperidine-1-carboxylate |
| PubChem CID | 122164103 |
| Molecular Formula | C10H19FN2O2 |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | tert-butyl (3S,5S)-3-amino-5-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](N)C[C@H](F)C1 |
| InChI | InChI=1S/C10H19FN2O2/c1-10(2,3)15-9(14)13-5-7(11)4-8(12)6-13/h7-8H,4-6,12H2,1-3H3/t7-,8-/m0/s1 |
| InChIKey | QHVIBSNJHHGNCZ-YUMQZZPRSA-N |
| XLogP | 1.29 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl (3S,5S)-3-amino-5-fluoropiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3S,5S)-3-amino-5-fluoropiperidine-1-carboxylate?
The IUPAC name of tert-butyl (3S,5S)-3-amino-5-fluoropiperidine-1-carboxylate (CID 122164103) is tert-butyl (3S,5S)-3-amino-5-fluoropiperidine-1-carboxylate.
What is the SMILES notation for tert-butyl (3S,5S)-3-amino-5-fluoropiperidine-1-carboxylate?
The canonical SMILES for tert-butyl (3S,5S)-3-amino-5-fluoropiperidine-1-carboxylate is CC(C)(C)OC(=O)N1C[C@@H](N)C[C@H](F)C1.
What is the InChIKey of tert-butyl (3S,5S)-3-amino-5-fluoropiperidine-1-carboxylate?
The InChIKey is QHVIBSNJHHGNCZ-YUMQZZPRSA-N. The full InChI is InChI=1S/C10H19FN2O2/c1-10(2,3)15-9(14)13-5-7(11)4-8(12)6-13/h7-8H,4-6,12H2,1-3H3/t7-,8-/m0/s1.
What are the key properties of tert-butyl (3S,5S)-3-amino-5-fluoropiperidine-1-carboxylate?
tert-butyl (3S,5S)-3-amino-5-fluoropiperidine-1-carboxylate has a molecular weight of 218.27 g/mol, XLogP of 1.29, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3S,5S)-3-amino-5-fluoropiperidine-1-carboxylate is sourced from PubChem (CID 122164103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).