morpholin-2-ylmethanesulfonyl fluoride

C5H10FNO3S — CID 122164145

IUPACmorpholin-2-ylmethanesulfonyl fluoride
SMILESO=S(=O)(F)CC1CNCCO1
InChIInChI=1S/C5H10FNO3S/c6-11(8,9)4-5-3-7-1-2-10-5/h5,7H,1-4H2
InChIKeyJTQDVOLRALOGDC-UHFFFAOYSA-N
MW183.20 g/mol
LogP-0.73
Rot. Bonds2

About morpholin-2-ylmethanesulfonyl fluoride

morpholin-2-ylmethanesulfonyl fluoride (PubChem CID 122164145) has the molecular formula C5H10FNO3S and a molecular weight of 183.20 g/mol. Its IUPAC name is morpholin-2-ylmethanesulfonyl fluoride.

Molecular Properties

Compound Namemorpholin-2-ylmethanesulfonyl fluoride
PubChem CID122164145
Molecular FormulaC5H10FNO3S
Molecular Weight183.20 g/mol
Exact Mass183.04
IUPAC Namemorpholin-2-ylmethanesulfonyl fluoride
SMILESO=S(=O)(F)CC1CNCCO1
InChIInChI=1S/C5H10FNO3S/c6-11(8,9)4-5-3-7-1-2-10-5/h5,7H,1-4H2
InChIKeyJTQDVOLRALOGDC-UHFFFAOYSA-N
XLogP-0.73
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.20
LogP ≤ 5-0.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze morpholin-2-ylmethanesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of morpholin-2-ylmethanesulfonyl fluoride?
The IUPAC name of morpholin-2-ylmethanesulfonyl fluoride (CID 122164145) is morpholin-2-ylmethanesulfonyl fluoride.
What is the SMILES notation for morpholin-2-ylmethanesulfonyl fluoride?
The canonical SMILES for morpholin-2-ylmethanesulfonyl fluoride is O=S(=O)(F)CC1CNCCO1.
What is the InChIKey of morpholin-2-ylmethanesulfonyl fluoride?
The InChIKey is JTQDVOLRALOGDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10FNO3S/c6-11(8,9)4-5-3-7-1-2-10-5/h5,7H,1-4H2.
What are the key properties of morpholin-2-ylmethanesulfonyl fluoride?
morpholin-2-ylmethanesulfonyl fluoride has a molecular weight of 183.20 g/mol, XLogP of -0.73, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-2-ylmethanesulfonyl fluoride is sourced from PubChem (CID 122164145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).