About (3R,5R)-3,5-dimethylpiperidin-4-one;hydrochloride
(3R,5R)-3,5-dimethylpiperidin-4-one;hydrochloride (PubChem CID 122164161) has the molecular formula C7H14ClNO
and a molecular weight of 163.65 g/mol. Its IUPAC name is (3R,5R)-3,5-dimethylpiperidin-4-one;hydrochloride.
Molecular Properties
| Compound Name | (3R,5R)-3,5-dimethylpiperidin-4-one;hydrochloride |
| PubChem CID | 122164161 |
| Molecular Formula | C7H14ClNO |
| Molecular Weight | 163.65 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | (3R,5R)-3,5-dimethylpiperidin-4-one;hydrochloride |
| SMILES | C[C@@H]1CNC[C@@H](C)C1=O.Cl |
| InChI | InChI=1S/C7H13NO.ClH/c1-5-3-8-4-6(2)7(5)9;/h5-6,8H,3-4H2,1-2H3;1H/t5-,6-;/m1./s1 |
| InChIKey | KGOSYMJHQHVVLJ-KGZKBUQUSA-N |
| XLogP | 0.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.65 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R,5R)-3,5-dimethylpiperidin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5R)-3,5-dimethylpiperidin-4-one;hydrochloride?
The IUPAC name of (3R,5R)-3,5-dimethylpiperidin-4-one;hydrochloride (CID 122164161) is (3R,5R)-3,5-dimethylpiperidin-4-one;hydrochloride.
What is the SMILES notation for (3R,5R)-3,5-dimethylpiperidin-4-one;hydrochloride?
The canonical SMILES for (3R,5R)-3,5-dimethylpiperidin-4-one;hydrochloride is C[C@@H]1CNC[C@@H](C)C1=O.Cl.
What is the InChIKey of (3R,5R)-3,5-dimethylpiperidin-4-one;hydrochloride?
The InChIKey is KGOSYMJHQHVVLJ-KGZKBUQUSA-N. The full InChI is InChI=1S/C7H13NO.ClH/c1-5-3-8-4-6(2)7(5)9;/h5-6,8H,3-4H2,1-2H3;1H/t5-,6-;/m1./s1.
What are the key properties of (3R,5R)-3,5-dimethylpiperidin-4-one;hydrochloride?
(3R,5R)-3,5-dimethylpiperidin-4-one;hydrochloride has a molecular weight of 163.65 g/mol, XLogP of 0.85, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5R)-3,5-dimethylpiperidin-4-one;hydrochloride is sourced from PubChem (CID 122164161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).