About 3-phenylsulfanylaniline;hydrochloride
3-phenylsulfanylaniline;hydrochloride (PubChem CID 122164312) has the molecular formula C12H12ClNS
and a molecular weight of 237.76 g/mol. Its IUPAC name is 3-phenylsulfanylaniline;hydrochloride.
Molecular Properties
| Compound Name | 3-phenylsulfanylaniline;hydrochloride |
| PubChem CID | 122164312 |
| Molecular Formula | C12H12ClNS |
| Molecular Weight | 237.76 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 3-phenylsulfanylaniline;hydrochloride |
| SMILES | Cl.Nc1cccc(Sc2ccccc2)c1 |
| InChI | InChI=1S/C12H11NS.ClH/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11;/h1-9H,13H2;1H |
| InChIKey | JBNPXZDDLIRRTF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.76 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylsulfanylaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylsulfanylaniline;hydrochloride?
The IUPAC name of 3-phenylsulfanylaniline;hydrochloride (CID 122164312) is 3-phenylsulfanylaniline;hydrochloride.
What is the SMILES notation for 3-phenylsulfanylaniline;hydrochloride?
The canonical SMILES for 3-phenylsulfanylaniline;hydrochloride is Cl.Nc1cccc(Sc2ccccc2)c1.
What is the InChIKey of 3-phenylsulfanylaniline;hydrochloride?
The InChIKey is JBNPXZDDLIRRTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NS.ClH/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11;/h1-9H,13H2;1H.
What are the key properties of 3-phenylsulfanylaniline;hydrochloride?
3-phenylsulfanylaniline;hydrochloride has a molecular weight of 237.76 g/mol, XLogP of 3.84, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylsulfanylaniline;hydrochloride is sourced from PubChem (CID 122164312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).