About 6,6-dibromo-3-azabicyclo[3.1.0]hexane;hydrochloride
6,6-dibromo-3-azabicyclo[3.1.0]hexane;hydrochloride (PubChem CID 122164446) has the molecular formula C5H8Br2ClN
and a molecular weight of 277.39 g/mol. Its IUPAC name is 6,6-dibromo-3-azabicyclo[3.1.0]hexane;hydrochloride.
Molecular Properties
| Compound Name | 6,6-dibromo-3-azabicyclo[3.1.0]hexane;hydrochloride |
| PubChem CID | 122164446 |
| Molecular Formula | C5H8Br2ClN |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 274.87 |
| IUPAC Name | 6,6-dibromo-3-azabicyclo[3.1.0]hexane;hydrochloride |
| SMILES | BrC1(Br)C2CNCC21.Cl |
| InChI | InChI=1S/C5H7Br2N.ClH/c6-5(7)3-1-8-2-4(3)5;/h3-4,8H,1-2H2;1H |
| InChIKey | YFJHVIBFAIJJEV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dibromo-3-azabicyclo[3.1.0]hexane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dibromo-3-azabicyclo[3.1.0]hexane;hydrochloride?
The IUPAC name of 6,6-dibromo-3-azabicyclo[3.1.0]hexane;hydrochloride (CID 122164446) is 6,6-dibromo-3-azabicyclo[3.1.0]hexane;hydrochloride.
What is the SMILES notation for 6,6-dibromo-3-azabicyclo[3.1.0]hexane;hydrochloride?
The canonical SMILES for 6,6-dibromo-3-azabicyclo[3.1.0]hexane;hydrochloride is BrC1(Br)C2CNCC21.Cl.
What is the InChIKey of 6,6-dibromo-3-azabicyclo[3.1.0]hexane;hydrochloride?
The InChIKey is YFJHVIBFAIJJEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7Br2N.ClH/c6-5(7)3-1-8-2-4(3)5;/h3-4,8H,1-2H2;1H.
What are the key properties of 6,6-dibromo-3-azabicyclo[3.1.0]hexane;hydrochloride?
6,6-dibromo-3-azabicyclo[3.1.0]hexane;hydrochloride has a molecular weight of 277.39 g/mol, XLogP of 1.74, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dibromo-3-azabicyclo[3.1.0]hexane;hydrochloride is sourced from PubChem (CID 122164446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).