About 3-amino-2,4-dihydrochromene-3-carbonitrile;hydrochloride
3-amino-2,4-dihydrochromene-3-carbonitrile;hydrochloride (PubChem CID 122164502) has the molecular formula C10H11ClN2O
and a molecular weight of 210.66 g/mol. Its IUPAC name is 3-amino-2,4-dihydrochromene-3-carbonitrile;hydrochloride.
Molecular Properties
| Compound Name | 3-amino-2,4-dihydrochromene-3-carbonitrile;hydrochloride |
| PubChem CID | 122164502 |
| Molecular Formula | C10H11ClN2O |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 3-amino-2,4-dihydrochromene-3-carbonitrile;hydrochloride |
| SMILES | Cl.N#CC1(N)COc2ccccc2C1 |
| InChI | InChI=1S/C10H10N2O.ClH/c11-6-10(12)5-8-3-1-2-4-9(8)13-7-10;/h1-4H,5,7,12H2;1H |
| InChIKey | PZSBMJXSZAGWSJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-2,4-dihydrochromene-3-carbonitrile;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2,4-dihydrochromene-3-carbonitrile;hydrochloride?
The IUPAC name of 3-amino-2,4-dihydrochromene-3-carbonitrile;hydrochloride (CID 122164502) is 3-amino-2,4-dihydrochromene-3-carbonitrile;hydrochloride.
What is the SMILES notation for 3-amino-2,4-dihydrochromene-3-carbonitrile;hydrochloride?
The canonical SMILES for 3-amino-2,4-dihydrochromene-3-carbonitrile;hydrochloride is Cl.N#CC1(N)COc2ccccc2C1.
What is the InChIKey of 3-amino-2,4-dihydrochromene-3-carbonitrile;hydrochloride?
The InChIKey is PZSBMJXSZAGWSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O.ClH/c11-6-10(12)5-8-3-1-2-4-9(8)13-7-10;/h1-4H,5,7,12H2;1H.
What are the key properties of 3-amino-2,4-dihydrochromene-3-carbonitrile;hydrochloride?
3-amino-2,4-dihydrochromene-3-carbonitrile;hydrochloride has a molecular weight of 210.66 g/mol, XLogP of 1.26, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2,4-dihydrochromene-3-carbonitrile;hydrochloride is sourced from PubChem (CID 122164502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).