About 2-amino-2-(4-methyl-1,2,4-triazol-3-yl)ethanol;dihydrochloride
2-amino-2-(4-methyl-1,2,4-triazol-3-yl)ethanol;dihydrochloride (PubChem CID 122164519) has the molecular formula C5H12Cl2N4O
and a molecular weight of 215.08 g/mol. Its IUPAC name is 2-amino-2-(4-methyl-1,2,4-triazol-3-yl)ethanol;dihydrochloride.
Molecular Properties
| Compound Name | 2-amino-2-(4-methyl-1,2,4-triazol-3-yl)ethanol;dihydrochloride |
| PubChem CID | 122164519 |
| Molecular Formula | C5H12Cl2N4O |
| Molecular Weight | 215.08 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 2-amino-2-(4-methyl-1,2,4-triazol-3-yl)ethanol;dihydrochloride |
| SMILES | Cl.Cl.Cn1cnnc1C(N)CO |
| InChI | InChI=1S/C5H10N4O.2ClH/c1-9-3-7-8-5(9)4(6)2-10;;/h3-4,10H,2,6H2,1H3;2*1H |
| InChIKey | DGASLTKIUHBZHX-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.08 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-2-(4-methyl-1,2,4-triazol-3-yl)ethanol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-(4-methyl-1,2,4-triazol-3-yl)ethanol;dihydrochloride?
The IUPAC name of 2-amino-2-(4-methyl-1,2,4-triazol-3-yl)ethanol;dihydrochloride (CID 122164519) is 2-amino-2-(4-methyl-1,2,4-triazol-3-yl)ethanol;dihydrochloride.
What is the SMILES notation for 2-amino-2-(4-methyl-1,2,4-triazol-3-yl)ethanol;dihydrochloride?
The canonical SMILES for 2-amino-2-(4-methyl-1,2,4-triazol-3-yl)ethanol;dihydrochloride is Cl.Cl.Cn1cnnc1C(N)CO.
What is the InChIKey of 2-amino-2-(4-methyl-1,2,4-triazol-3-yl)ethanol;dihydrochloride?
The InChIKey is DGASLTKIUHBZHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4O.2ClH/c1-9-3-7-8-5(9)4(6)2-10;;/h3-4,10H,2,6H2,1H3;2*1H.
What are the key properties of 2-amino-2-(4-methyl-1,2,4-triazol-3-yl)ethanol;dihydrochloride?
2-amino-2-(4-methyl-1,2,4-triazol-3-yl)ethanol;dihydrochloride has a molecular weight of 215.08 g/mol, XLogP of -0.35, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(4-methyl-1,2,4-triazol-3-yl)ethanol;dihydrochloride is sourced from PubChem (CID 122164519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).