About 2-[6-(cyclobutylamino)-1,3-benzothiazol-2-yl]-1,3-thiazol-4-one
2-[6-(cyclobutylamino)-1,3-benzothiazol-2-yl]-1,3-thiazol-4-one (PubChem CID 122164597) has the molecular formula C14H13N3OS2
and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-[6-(cyclobutylamino)-1,3-benzothiazol-2-yl]-1,3-thiazol-4-one.
Molecular Properties
| Compound Name | 2-[6-(cyclobutylamino)-1,3-benzothiazol-2-yl]-1,3-thiazol-4-one |
| PubChem CID | 122164597 |
| Molecular Formula | C14H13N3OS2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 2-[6-(cyclobutylamino)-1,3-benzothiazol-2-yl]-1,3-thiazol-4-one |
| SMILES | O=C1CSC(c2nc3ccc(NC4CCC4)cc3s2)=N1 |
| InChI | InChI=1S/C14H13N3OS2/c18-12-7-19-13(17-12)14-16-10-5-4-9(6-11(10)20-14)15-8-2-1-3-8/h4-6,8,15H,1-3,7H2 |
| InChIKey | RQMFMWBWCNBUOD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[6-(cyclobutylamino)-1,3-benzothiazol-2-yl]-1,3-thiazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(cyclobutylamino)-1,3-benzothiazol-2-yl]-1,3-thiazol-4-one?
The IUPAC name of 2-[6-(cyclobutylamino)-1,3-benzothiazol-2-yl]-1,3-thiazol-4-one (CID 122164597) is 2-[6-(cyclobutylamino)-1,3-benzothiazol-2-yl]-1,3-thiazol-4-one.
What is the SMILES notation for 2-[6-(cyclobutylamino)-1,3-benzothiazol-2-yl]-1,3-thiazol-4-one?
The canonical SMILES for 2-[6-(cyclobutylamino)-1,3-benzothiazol-2-yl]-1,3-thiazol-4-one is O=C1CSC(c2nc3ccc(NC4CCC4)cc3s2)=N1.
What is the InChIKey of 2-[6-(cyclobutylamino)-1,3-benzothiazol-2-yl]-1,3-thiazol-4-one?
The InChIKey is RQMFMWBWCNBUOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3OS2/c18-12-7-19-13(17-12)14-16-10-5-4-9(6-11(10)20-14)15-8-2-1-3-8/h4-6,8,15H,1-3,7H2.
What are the key properties of 2-[6-(cyclobutylamino)-1,3-benzothiazol-2-yl]-1,3-thiazol-4-one?
2-[6-(cyclobutylamino)-1,3-benzothiazol-2-yl]-1,3-thiazol-4-one has a molecular weight of 303.41 g/mol, XLogP of 3.28, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(cyclobutylamino)-1,3-benzothiazol-2-yl]-1,3-thiazol-4-one is sourced from PubChem (CID 122164597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).