C30H34FN5O4S — CID 122164743
N-[(1S)-1-cyclopentyl-2-[(6R)-6-ethynyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-2-oxoethyl]-4-[5-fluoro-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide (PubChem CID 122164743) has the molecular formula C30H34FN5O4S and a molecular weight of 579.70 g/mol. Its IUPAC name is N-[(1S)-1-cyclopentyl-2-[(6R)-6-ethynyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-2-oxoethyl]-4-[5-fluoro-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[(1S)-1-cyclopentyl-2-[(6R)-6-ethynyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-2-oxoethyl]-4-[5-fluoro-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 122164743 |
| Molecular Formula | C30H34FN5O4S |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | N-[(1S)-1-cyclopentyl-2-[(6R)-6-ethynyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-2-oxoethyl]-4-[5-fluoro-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
| SMILES | C#C[C@@H]1CN(C(=O)[C@@H](NC(=O)c2ccc(-c3nc(N4CCN(C)CC4)sc3F)cc2)C2CCCC2)C2C(=O)COC21 |
| InChI | InChI=1S/C30H34FN5O4S/c1-3-18-16-36(25-22(37)17-40-26(18)25)29(39)24(19-6-4-5-7-19)32-28(38)21-10-8-20(9-11-21)23-27(31)41-30(33-23)35-14-12-34(2)13-15-35/h1,8-11,18-19,24-26H,4-7,12-17H2,2H3,(H,32,38)/t18-,24+,25?,26?/m1/s1 |
| InChIKey | DEMUCOOCKQGXOE-NJHUVSBTSA-N |
| XLogP | 2.42 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|