C21H28N6O4 — CID 122164885
(2S,5S,11S)-5-benzyl-13-ethyl-2,11-dimethyl-17-oxa-3,6,9,12,15,16-hexazabicyclo[12.2.1]heptadeca-1(16),14-diene-4,7,10-trione (PubChem CID 122164885) has the molecular formula C21H28N6O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is (2S,5S,11S)-5-benzyl-13-ethyl-2,11-dimethyl-17-oxa-3,6,9,12,15,16-hexazabicyclo[12.2.1]heptadeca-1(16),14-diene-4,7,10-trione.
| Compound Name | (2S,5S,11S)-5-benzyl-13-ethyl-2,11-dimethyl-17-oxa-3,6,9,12,15,16-hexazabicyclo[12.2.1]heptadeca-1(16),14-diene-4,7,10-trione |
|---|---|
| PubChem CID | 122164885 |
| Molecular Formula | C21H28N6O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | (2S,5S,11S)-5-benzyl-13-ethyl-2,11-dimethyl-17-oxa-3,6,9,12,15,16-hexazabicyclo[12.2.1]heptadeca-1(16),14-diene-4,7,10-trione |
| SMILES | CCC1N[C@@H](C)C(=O)NCC(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](C)c2nnc1o2 |
| InChI | InChI=1S/C21H28N6O4/c1-4-15-21-27-26-20(31-21)13(3)24-19(30)16(10-14-8-6-5-7-9-14)25-17(28)11-22-18(29)12(2)23-15/h5-9,12-13,15-16,23H,4,10-11H2,1-3H3,(H,22,29)(H,24,30)(H,25,28)/t12-,13-,15?,16-/m0/s1 |
| InChIKey | BTHOIQFNMFPYKC-KVROMUSXSA-N |
| XLogP | 0.53 |
| TPSA | 138.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |