C26H30N6O4 — CID 122164908
(2S,5S,11S)-5,13-dibenzyl-2,11-dimethyl-17-oxa-3,6,9,12,15,16-hexazabicyclo[12.2.1]heptadeca-1(16),14-diene-4,7,10-trione (PubChem CID 122164908) has the molecular formula C26H30N6O4 and a molecular weight of 490.56 g/mol. Its IUPAC name is (2S,5S,11S)-5,13-dibenzyl-2,11-dimethyl-17-oxa-3,6,9,12,15,16-hexazabicyclo[12.2.1]heptadeca-1(16),14-diene-4,7,10-trione.
| Compound Name | (2S,5S,11S)-5,13-dibenzyl-2,11-dimethyl-17-oxa-3,6,9,12,15,16-hexazabicyclo[12.2.1]heptadeca-1(16),14-diene-4,7,10-trione |
|---|---|
| PubChem CID | 122164908 |
| Molecular Formula | C26H30N6O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | (2S,5S,11S)-5,13-dibenzyl-2,11-dimethyl-17-oxa-3,6,9,12,15,16-hexazabicyclo[12.2.1]heptadeca-1(16),14-diene-4,7,10-trione |
| SMILES | C[C@@H]1NC(Cc2ccccc2)c2nnc(o2)[C@H](C)NC(=O)[C@H](Cc2ccccc2)NC(=O)CNC1=O |
| InChI | InChI=1S/C26H30N6O4/c1-16-23(34)27-15-22(33)30-20(13-18-9-5-3-6-10-18)24(35)29-17(2)25-31-32-26(36-25)21(28-16)14-19-11-7-4-8-12-19/h3-12,16-17,20-21,28H,13-15H2,1-2H3,(H,27,34)(H,29,35)(H,30,33)/t16-,17-,20-,21?/m0/s1 |
| InChIKey | FFWFQKIOJXHRPR-SLTGRBBCSA-N |
| XLogP | 1.37 |
| TPSA | 138.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |