About 4-methylphenol;tricyclo[5.2.2.02,6]undecane
4-methylphenol;tricyclo[5.2.2.02,6]undecane (PubChem CID 122164942) has the molecular formula C18H26O
and a molecular weight of 258.40 g/mol. Its IUPAC name is 4-methylphenol;tricyclo[5.2.2.02,6]undecane.
Molecular Properties
| Compound Name | 4-methylphenol;tricyclo[5.2.2.02,6]undecane |
| PubChem CID | 122164942 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 4-methylphenol;tricyclo[5.2.2.02,6]undecane |
| SMILES | C1CC2C3CCC(CC3)C2C1.Cc1ccc(O)cc1 |
| InChI | InChI=1S/C11H18.C7H8O/c1-2-10-8-4-6-9(7-5-8)11(10)3-1;1-6-2-4-7(8)5-3-6/h8-11H,1-7H2;2-5,8H,1H3 |
| InChIKey | WHFFZLLDPXGFIX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methylphenol;tricyclo[5.2.2.02,6]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylphenol;tricyclo[5.2.2.02,6]undecane?
The IUPAC name of 4-methylphenol;tricyclo[5.2.2.02,6]undecane (CID 122164942) is 4-methylphenol;tricyclo[5.2.2.02,6]undecane.
What is the SMILES notation for 4-methylphenol;tricyclo[5.2.2.02,6]undecane?
The canonical SMILES for 4-methylphenol;tricyclo[5.2.2.02,6]undecane is C1CC2C3CCC(CC3)C2C1.Cc1ccc(O)cc1.
What is the InChIKey of 4-methylphenol;tricyclo[5.2.2.02,6]undecane?
The InChIKey is WHFFZLLDPXGFIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18.C7H8O/c1-2-10-8-4-6-9(7-5-8)11(10)3-1;1-6-2-4-7(8)5-3-6/h8-11H,1-7H2;2-5,8H,1H3.
What are the key properties of 4-methylphenol;tricyclo[5.2.2.02,6]undecane?
4-methylphenol;tricyclo[5.2.2.02,6]undecane has a molecular weight of 258.40 g/mol, XLogP of 4.92, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylphenol;tricyclo[5.2.2.02,6]undecane is sourced from PubChem (CID 122164942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).