C25H35N3O6 — CID 122165061
(1R,5S,21S,24S)-24-hydroxy-7-(oxan-4-yl)-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-triene-4,11-dione (PubChem CID 122165061) has the molecular formula C25H35N3O6 and a molecular weight of 473.57 g/mol. Its IUPAC name is (1R,5S,21S,24S)-24-hydroxy-7-(oxan-4-yl)-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-triene-4,11-dione.
| Compound Name | (1R,5S,21S,24S)-24-hydroxy-7-(oxan-4-yl)-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-triene-4,11-dione |
|---|---|
| PubChem CID | 122165061 |
| Molecular Formula | C25H35N3O6 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | (1R,5S,21S,24S)-24-hydroxy-7-(oxan-4-yl)-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-triene-4,11-dione |
| SMILES | O=C1NC[C@H]2O[C@H](CCOc3ccccc3C(=O)N3CCN(C4CCOCC4)C[C@@H]13)CC[C@@H]2O |
| InChI | InChI=1S/C25H35N3O6/c29-21-6-5-18-9-14-33-22-4-2-1-3-19(22)25(31)28-11-10-27(17-7-12-32-13-8-17)16-20(28)24(30)26-15-23(21)34-18/h1-4,17-18,20-21,23,29H,5-16H2,(H,26,30)/t18-,20-,21-,23+/m0/s1 |
| InChIKey | DHJUCNOFAGTERD-XHRGMSINSA-N |
| XLogP | 0.80 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |