C28H38N6O5 — CID 122165153
(1R,5S,21S,24R)-7-cyclobutyl-24-[4-(methoxymethyl)triazol-1-yl]-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-triene-4,11-dione (PubChem CID 122165153) has the molecular formula C28H38N6O5 and a molecular weight of 538.65 g/mol. Its IUPAC name is (1R,5S,21S,24R)-7-cyclobutyl-24-[4-(methoxymethyl)triazol-1-yl]-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-triene-4,11-dione.
| Compound Name | (1R,5S,21S,24R)-7-cyclobutyl-24-[4-(methoxymethyl)triazol-1-yl]-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-triene-4,11-dione |
|---|---|
| PubChem CID | 122165153 |
| Molecular Formula | C28H38N6O5 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | (1R,5S,21S,24R)-7-cyclobutyl-24-[4-(methoxymethyl)triazol-1-yl]-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-triene-4,11-dione |
| SMILES | COCc1cn([C@@H]2CC[C@H]3CCOc4ccccc4C(=O)N4CCN(C5CCC5)C[C@H]4C(=O)NC[C@H]2O3)nn1 |
| InChI | InChI=1S/C28H38N6O5/c1-37-18-19-16-34(31-30-19)23-10-9-21-11-14-38-25-8-3-2-7-22(25)28(36)33-13-12-32(20-5-4-6-20)17-24(33)27(35)29-15-26(23)39-21/h2-3,7-8,16,20-21,23-24,26H,4-6,9-15,17-18H2,1H3,(H,29,35)/t21-,23+,24-,26+/m0/s1 |
| InChIKey | OBXLKJVYHYTZDJ-GEMTWJNPSA-N |
| XLogP | 1.79 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |