C33H47N7O5 — CID 122165186
(1R,5S,21S,24R)-7-cyclohexyl-24-[4-(morpholin-4-ylmethyl)triazol-1-yl]-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-triene-4,11-dione (PubChem CID 122165186) has the molecular formula C33H47N7O5 and a molecular weight of 621.78 g/mol. Its IUPAC name is (1R,5S,21S,24R)-7-cyclohexyl-24-[4-(morpholin-4-ylmethyl)triazol-1-yl]-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-triene-4,11-dione.
| Compound Name | (1R,5S,21S,24R)-7-cyclohexyl-24-[4-(morpholin-4-ylmethyl)triazol-1-yl]-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-triene-4,11-dione |
|---|---|
| PubChem CID | 122165186 |
| Molecular Formula | C33H47N7O5 |
| Molecular Weight | 621.78 g/mol |
| Exact Mass | 621.36 |
| IUPAC Name | (1R,5S,21S,24R)-7-cyclohexyl-24-[4-(morpholin-4-ylmethyl)triazol-1-yl]-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-triene-4,11-dione |
| SMILES | O=C1NC[C@H]2O[C@H](CCOc3ccccc3C(=O)N3CCN(C4CCCCC4)C[C@@H]13)CC[C@H]2n1cc(CN2CCOCC2)nn1 |
| InChI | InChI=1S/C33H47N7O5/c41-32-29-23-38(25-6-2-1-3-7-25)13-14-39(29)33(42)27-8-4-5-9-30(27)44-17-12-26-10-11-28(31(45-26)20-34-32)40-22-24(35-36-40)21-37-15-18-43-19-16-37/h4-5,8-9,22,25-26,28-29,31H,1-3,6-7,10-21,23H2,(H,34,41)/t26-,28+,29-,31+/m0/s1 |
| InChIKey | DRWRFXUMZHGSFD-CLWAWUJFSA-N |
| XLogP | 2.26 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.78 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |