C13H24F2N4 — CID 122166252
N-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 122166252) has the molecular formula C13H24F2N4 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 122166252 |
| Molecular Formula | C13H24F2N4 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | N-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNCc1cnn(CC(F)F)c1 |
| InChI | InChI=1S/C13H24F2N4/c1-3-18(4-2)7-5-6-16-8-12-9-17-19(10-12)11-13(14)15/h9-10,13,16H,3-8,11H2,1-2H3 |
| InChIKey | HBHLUHHSAKELII-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|