C13H22F2N4O — CID 122166298
N-[[1-(2,2-difluoroethyl)-5-methylpyrazol-4-yl]methyl]-2-morpholin-4-ylethanamine (PubChem CID 122166298) has the molecular formula C13H22F2N4O and a molecular weight of 288.34 g/mol. Its IUPAC name is N-[[1-(2,2-difluoroethyl)-5-methylpyrazol-4-yl]methyl]-2-morpholin-4-ylethanamine.
| Compound Name | N-[[1-(2,2-difluoroethyl)-5-methylpyrazol-4-yl]methyl]-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 122166298 |
| Molecular Formula | C13H22F2N4O |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | N-[[1-(2,2-difluoroethyl)-5-methylpyrazol-4-yl]methyl]-2-morpholin-4-ylethanamine |
| SMILES | Cc1c(CNCCN2CCOCC2)cnn1CC(F)F |
| InChI | InChI=1S/C13H22F2N4O/c1-11-12(9-17-19(11)10-13(14)15)8-16-2-3-18-4-6-20-7-5-18/h9,13,16H,2-8,10H2,1H3 |
| InChIKey | CAOIGSNCGLNYGB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|