C5H4ClN7O2 — CID 1221663
5-(3-chloro-1,2,4-triazol-1-yl)-1-methyl-3-nitro-1,2,4-triazole (PubChem CID 1221663) has the molecular formula C5H4ClN7O2 and a molecular weight of 229.59 g/mol. Its IUPAC name is 5-(3-chloro-1,2,4-triazol-1-yl)-1-methyl-3-nitro-1,2,4-triazole.
| Compound Name | 5-(3-chloro-1,2,4-triazol-1-yl)-1-methyl-3-nitro-1,2,4-triazole |
|---|---|
| PubChem CID | 1221663 |
| Molecular Formula | C5H4ClN7O2 |
| Molecular Weight | 229.59 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 5-(3-chloro-1,2,4-triazol-1-yl)-1-methyl-3-nitro-1,2,4-triazole |
| SMILES | Cn1nc([N+](=O)[O-])nc1-n1cnc(Cl)n1 |
| InChI | InChI=1S/C5H4ClN7O2/c1-11-5(8-4(10-11)13(14)15)12-2-7-3(6)9-12/h2H,1H3 |
| InChIKey | RPQIVKISMOOYQJ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 104.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.59 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|