C11H16FN5 — CID 122166515
1-(2-fluoroethyl)-4-methyl-N-[(2-methylpyrazol-3-yl)methyl]pyrazol-3-amine (PubChem CID 122166515) has the molecular formula C11H16FN5 and a molecular weight of 237.28 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-4-methyl-N-[(2-methylpyrazol-3-yl)methyl]pyrazol-3-amine.
| Compound Name | 1-(2-fluoroethyl)-4-methyl-N-[(2-methylpyrazol-3-yl)methyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 122166515 |
| Molecular Formula | C11H16FN5 |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 1-(2-fluoroethyl)-4-methyl-N-[(2-methylpyrazol-3-yl)methyl]pyrazol-3-amine |
| SMILES | Cc1cn(CCF)nc1NCc1ccnn1C |
| InChI | InChI=1S/C11H16FN5/c1-9-8-17(6-4-12)15-11(9)13-7-10-3-5-14-16(10)2/h3,5,8H,4,6-7H2,1-2H3,(H,13,15) |
| InChIKey | OHHYESCRSNVYNK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |