C11H16FN5 — CID 122166526
N-[[1-(2-fluoroethyl)pyrazol-4-yl]methyl]-1-(1-methylpyrazol-3-yl)methanamine (PubChem CID 122166526) has the molecular formula C11H16FN5 and a molecular weight of 237.28 g/mol. Its IUPAC name is N-[[1-(2-fluoroethyl)pyrazol-4-yl]methyl]-1-(1-methylpyrazol-3-yl)methanamine.
| Compound Name | N-[[1-(2-fluoroethyl)pyrazol-4-yl]methyl]-1-(1-methylpyrazol-3-yl)methanamine |
|---|---|
| PubChem CID | 122166526 |
| Molecular Formula | C11H16FN5 |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | N-[[1-(2-fluoroethyl)pyrazol-4-yl]methyl]-1-(1-methylpyrazol-3-yl)methanamine |
| SMILES | Cn1ccc(CNCc2cnn(CCF)c2)n1 |
| InChI | InChI=1S/C11H16FN5/c1-16-4-2-11(15-16)8-13-6-10-7-14-17(9-10)5-3-12/h2,4,7,9,13H,3,5-6,8H2,1H3 |
| InChIKey | CHUMFCGOZKRKPV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |