C11H14F3N5O — CID 122167820
2-[4-[[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]methylamino]pyrazol-1-yl]ethanol (PubChem CID 122167820) has the molecular formula C11H14F3N5O and a molecular weight of 289.26 g/mol. Its IUPAC name is 2-[4-[[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]methylamino]pyrazol-1-yl]ethanol.
| Compound Name | 2-[4-[[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]methylamino]pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 122167820 |
| Molecular Formula | C11H14F3N5O |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-[4-[[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]methylamino]pyrazol-1-yl]ethanol |
| SMILES | Cn1nc(C(F)(F)F)cc1CNc1cnn(CCO)c1 |
| InChI | InChI=1S/C11H14F3N5O/c1-18-9(4-10(17-18)11(12,13)14)6-15-8-5-16-19(7-8)2-3-20/h4-5,7,15,20H,2-3,6H2,1H3 |
| InChIKey | ILWVMVNJGSUFMN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 67.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |