C9H9F2N3O — CID 122168918
1-(difluoromethyl)-N-(furan-2-ylmethyl)pyrazol-3-amine (PubChem CID 122168918) has the molecular formula C9H9F2N3O and a molecular weight of 213.19 g/mol. Its IUPAC name is 1-(difluoromethyl)-N-(furan-2-ylmethyl)pyrazol-3-amine.
| Compound Name | 1-(difluoromethyl)-N-(furan-2-ylmethyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 122168918 |
| Molecular Formula | C9H9F2N3O |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 1-(difluoromethyl)-N-(furan-2-ylmethyl)pyrazol-3-amine |
| SMILES | FC(F)n1ccc(NCc2ccco2)n1 |
| InChI | InChI=1S/C9H9F2N3O/c10-9(11)14-4-3-8(13-14)12-6-7-2-1-5-15-7/h1-5,9H,6H2,(H,12,13) |
| InChIKey | OBOQQQQABNZIBD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |