About 1-[(1,3-dimethylpyrazol-4-yl)methyl]-N-[(5-fluorothiophen-2-yl)methyl]pyrazol-4-amine
1-[(1,3-dimethylpyrazol-4-yl)methyl]-N-[(5-fluorothiophen-2-yl)methyl]pyrazol-4-amine (PubChem CID 122169302) has the molecular formula C14H16FN5S
and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-[(1,3-dimethylpyrazol-4-yl)methyl]-N-[(5-fluorothiophen-2-yl)methyl]pyrazol-4-amine.
Molecular Properties
| Compound Name | 1-[(1,3-dimethylpyrazol-4-yl)methyl]-N-[(5-fluorothiophen-2-yl)methyl]pyrazol-4-amine |
| PubChem CID | 122169302 |
| Molecular Formula | C14H16FN5S |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 1-[(1,3-dimethylpyrazol-4-yl)methyl]-N-[(5-fluorothiophen-2-yl)methyl]pyrazol-4-amine |
| SMILES | Cc1nn(C)cc1Cn1cc(NCc2ccc(F)s2)cn1 |
| InChI | InChI=1S/C14H16FN5S/c1-10-11(7-19(2)18-10)8-20-9-12(5-17-20)16-6-13-3-4-14(15)21-13/h3-5,7,9,16H,6,8H2,1-2H3 |
| InChIKey | WWYSANALWFFGAX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(1,3-dimethylpyrazol-4-yl)methyl]-N-[(5-fluorothiophen-2-yl)methyl]pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1,3-dimethylpyrazol-4-yl)methyl]-N-[(5-fluorothiophen-2-yl)methyl]pyrazol-4-amine?
The IUPAC name of 1-[(1,3-dimethylpyrazol-4-yl)methyl]-N-[(5-fluorothiophen-2-yl)methyl]pyrazol-4-amine (CID 122169302) is 1-[(1,3-dimethylpyrazol-4-yl)methyl]-N-[(5-fluorothiophen-2-yl)methyl]pyrazol-4-amine.
What is the SMILES notation for 1-[(1,3-dimethylpyrazol-4-yl)methyl]-N-[(5-fluorothiophen-2-yl)methyl]pyrazol-4-amine?
The canonical SMILES for 1-[(1,3-dimethylpyrazol-4-yl)methyl]-N-[(5-fluorothiophen-2-yl)methyl]pyrazol-4-amine is Cc1nn(C)cc1Cn1cc(NCc2ccc(F)s2)cn1.
What is the InChIKey of 1-[(1,3-dimethylpyrazol-4-yl)methyl]-N-[(5-fluorothiophen-2-yl)methyl]pyrazol-4-amine?
The InChIKey is WWYSANALWFFGAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16FN5S/c1-10-11(7-19(2)18-10)8-20-9-12(5-17-20)16-6-13-3-4-14(15)21-13/h3-5,7,9,16H,6,8H2,1-2H3.
What are the key properties of 1-[(1,3-dimethylpyrazol-4-yl)methyl]-N-[(5-fluorothiophen-2-yl)methyl]pyrazol-4-amine?
1-[(1,3-dimethylpyrazol-4-yl)methyl]-N-[(5-fluorothiophen-2-yl)methyl]pyrazol-4-amine has a molecular weight of 305.38 g/mol, XLogP of 2.79, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,3-dimethylpyrazol-4-yl)methyl]-N-[(5-fluorothiophen-2-yl)methyl]pyrazol-4-amine is sourced from PubChem (CID 122169302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).