C25H41N3O2S — CID 122169829
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(3-methoxypropyl)-2-(4-pyrrol-1-ylthian-4-yl)acetamide (PubChem CID 122169829) has the molecular formula C25H41N3O2S and a molecular weight of 447.69 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(3-methoxypropyl)-2-(4-pyrrol-1-ylthian-4-yl)acetamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(3-methoxypropyl)-2-(4-pyrrol-1-ylthian-4-yl)acetamide |
|---|---|
| PubChem CID | 122169829 |
| Molecular Formula | C25H41N3O2S |
| Molecular Weight | 447.69 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(3-methoxypropyl)-2-(4-pyrrol-1-ylthian-4-yl)acetamide |
| SMILES | COCCCN(C[C@@H]1CCCN2CCCC[C@H]12)C(=O)CC1(n2cccc2)CCSCC1 |
| InChI | InChI=1S/C25H41N3O2S/c1-30-17-7-14-27(21-22-8-6-13-26-12-3-2-9-23(22)26)24(29)20-25(10-18-31-19-11-25)28-15-4-5-16-28/h4-5,15-16,22-23H,2-3,6-14,17-21H2,1H3/t22-,23+/m0/s1 |
| InChIKey | VFJXFPQMINXEFS-XZOQPEGZSA-N |
| XLogP | 4.23 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.69 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|