C23H25NO8S — CID 122170124
(2E)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[(1-oxido-1-oxo-2,3,4,5-tetrahydrothiophen-3-yl)methylamino]ethylidene]dibenzofuran-1,3-dione (PubChem CID 122170124) has the molecular formula C23H25NO8S and a molecular weight of 475.52 g/mol. Its IUPAC name is (2E)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[(1-oxido-1-oxo-2,3,4,5-tetrahydrothiophen-3-yl)methylamino]ethylidene]dibenzofuran-1,3-dione.
| Compound Name | (2E)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[(1-oxido-1-oxo-2,3,4,5-tetrahydrothiophen-3-yl)methylamino]ethylidene]dibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 122170124 |
| Molecular Formula | C23H25NO8S |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | (2E)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[(1-oxido-1-oxo-2,3,4,5-tetrahydrothiophen-3-yl)methylamino]ethylidene]dibenzofuran-1,3-dione |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)/C(=C(/C)NCC3CC[S+](=O)([O-])C3)C(=O)C12C |
| InChI | InChI=1S/C23H25NO8S/c1-10-19(27)17(12(3)25)21-18(20(10)28)23(4)15(32-21)7-14(26)16(22(23)29)11(2)24-8-13-5-6-33(30,31)9-13/h7,13H,5-6,8-9H2,1-4H3,(H3-,24,25,26,27,28,29,30,31) |
| InChIKey | BHVRDUNYKAOQGW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 153.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|