C29H31NO10 — CID 122170153
methyl 3-[3-acetyl-2,6-dihydroxy-5-(7-hydroxy-6-methyl-1,3-dihydrofuro[3,4-c]pyridin-1-yl)phenyl]-3-(3,4,5-trimethoxyphenyl)propanoate (PubChem CID 122170153) has the molecular formula C29H31NO10 and a molecular weight of 553.56 g/mol. Its IUPAC name is methyl 3-[3-acetyl-2,6-dihydroxy-5-(7-hydroxy-6-methyl-1,3-dihydrofuro[3,4-c]pyridin-1-yl)phenyl]-3-(3,4,5-trimethoxyphenyl)propanoate.
| Compound Name | methyl 3-[3-acetyl-2,6-dihydroxy-5-(7-hydroxy-6-methyl-1,3-dihydrofuro[3,4-c]pyridin-1-yl)phenyl]-3-(3,4,5-trimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 122170153 |
| Molecular Formula | C29H31NO10 |
| Molecular Weight | 553.56 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | methyl 3-[3-acetyl-2,6-dihydroxy-5-(7-hydroxy-6-methyl-1,3-dihydrofuro[3,4-c]pyridin-1-yl)phenyl]-3-(3,4,5-trimethoxyphenyl)propanoate |
| SMILES | COC(=O)CC(c1cc(OC)c(OC)c(OC)c1)c1c(O)c(C(C)=O)cc(C2OCc3cnc(C)c(O)c32)c1O |
| InChI | InChI=1S/C29H31NO10/c1-13-25(33)23-16(11-30-13)12-40-28(23)19-9-17(14(2)31)26(34)24(27(19)35)18(10-22(32)38-5)15-7-20(36-3)29(39-6)21(8-15)37-4/h7-9,11,18,28,33-35H,10,12H2,1-6H3 |
| InChIKey | OOBYRKMMONJNMA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 153.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |