C6H2BrCl2N3 — CID 122170246
6-bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine (PubChem CID 122170246) has the molecular formula C6H2BrCl2N3 and a molecular weight of 266.91 g/mol. Its IUPAC name is 6-bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine.
| Compound Name | 6-bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 122170246 |
| Molecular Formula | C6H2BrCl2N3 |
| Molecular Weight | 266.91 g/mol |
| Exact Mass | 264.88 |
| IUPAC Name | 6-bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine |
| SMILES | Clc1nc(Cl)c2cc(Br)cn2n1 |
| InChI | InChI=1S/C6H2BrCl2N3/c7-3-1-4-5(8)10-6(9)11-12(4)2-3/h1-2H |
| InChIKey | NRVGOQKEQWXMOO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.91 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |