About ethyl 4-bromo-1-(3,3,3-trifluoropropyl)pyrazole-5-carboxylate
ethyl 4-bromo-1-(3,3,3-trifluoropropyl)pyrazole-5-carboxylate (PubChem CID 122171230) has the molecular formula C9H10BrF3N2O2
and a molecular weight of 315.09 g/mol. Its IUPAC name is ethyl 4-bromo-1-(3,3,3-trifluoropropyl)pyrazole-5-carboxylate.
Analyze ethyl 4-bromo-1-(3,3,3-trifluoropropyl)pyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-bromo-1-(3,3,3-trifluoropropyl)pyrazole-5-carboxylate?
The IUPAC name of ethyl 4-bromo-1-(3,3,3-trifluoropropyl)pyrazole-5-carboxylate (CID 122171230) is ethyl 4-bromo-1-(3,3,3-trifluoropropyl)pyrazole-5-carboxylate.
What is the SMILES notation for ethyl 4-bromo-1-(3,3,3-trifluoropropyl)pyrazole-5-carboxylate?
The canonical SMILES for ethyl 4-bromo-1-(3,3,3-trifluoropropyl)pyrazole-5-carboxylate is CCOC(=O)c1c(Br)cnn1CCC(F)(F)F.
What is the InChIKey of ethyl 4-bromo-1-(3,3,3-trifluoropropyl)pyrazole-5-carboxylate?
The InChIKey is YVORRUXXHUOMFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrF3N2O2/c1-2-17-8(16)7-6(10)5-14-15(7)4-3-9(11,12)13/h5H,2-4H2,1H3.
What are the key properties of ethyl 4-bromo-1-(3,3,3-trifluoropropyl)pyrazole-5-carboxylate?
ethyl 4-bromo-1-(3,3,3-trifluoropropyl)pyrazole-5-carboxylate has a molecular weight of 315.09 g/mol, XLogP of 2.77, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-bromo-1-(3,3,3-trifluoropropyl)pyrazole-5-carboxylate is sourced from PubChem (CID 122171230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).