About 4-chloro-3-(2,2-difluoroethoxymethyl)-1-(difluoromethyl)pyrazole
4-chloro-3-(2,2-difluoroethoxymethyl)-1-(difluoromethyl)pyrazole (PubChem CID 122171826) has the molecular formula C7H7ClF4N2O
and a molecular weight of 246.59 g/mol. Its IUPAC name is 4-chloro-3-(2,2-difluoroethoxymethyl)-1-(difluoromethyl)pyrazole.
Molecular Properties
| Compound Name | 4-chloro-3-(2,2-difluoroethoxymethyl)-1-(difluoromethyl)pyrazole |
| PubChem CID | 122171826 |
| Molecular Formula | C7H7ClF4N2O |
| Molecular Weight | 246.59 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 4-chloro-3-(2,2-difluoroethoxymethyl)-1-(difluoromethyl)pyrazole |
| SMILES | FC(F)COCc1nn(C(F)F)cc1Cl |
| InChI | InChI=1S/C7H7ClF4N2O/c8-4-1-14(7(11)12)13-5(4)2-15-3-6(9)10/h1,6-7H,2-3H2 |
| InChIKey | IWLCPOBZRWNJFH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.59 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-3-(2,2-difluoroethoxymethyl)-1-(difluoromethyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-(2,2-difluoroethoxymethyl)-1-(difluoromethyl)pyrazole?
The IUPAC name of 4-chloro-3-(2,2-difluoroethoxymethyl)-1-(difluoromethyl)pyrazole (CID 122171826) is 4-chloro-3-(2,2-difluoroethoxymethyl)-1-(difluoromethyl)pyrazole.
What is the SMILES notation for 4-chloro-3-(2,2-difluoroethoxymethyl)-1-(difluoromethyl)pyrazole?
The canonical SMILES for 4-chloro-3-(2,2-difluoroethoxymethyl)-1-(difluoromethyl)pyrazole is FC(F)COCc1nn(C(F)F)cc1Cl.
What is the InChIKey of 4-chloro-3-(2,2-difluoroethoxymethyl)-1-(difluoromethyl)pyrazole?
The InChIKey is IWLCPOBZRWNJFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClF4N2O/c8-4-1-14(7(11)12)13-5(4)2-15-3-6(9)10/h1,6-7H,2-3H2.
What are the key properties of 4-chloro-3-(2,2-difluoroethoxymethyl)-1-(difluoromethyl)pyrazole?
4-chloro-3-(2,2-difluoroethoxymethyl)-1-(difluoromethyl)pyrazole has a molecular weight of 246.59 g/mol, XLogP of 2.71, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-(2,2-difluoroethoxymethyl)-1-(difluoromethyl)pyrazole is sourced from PubChem (CID 122171826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).