C9H13F2IN2O — CID 122171847
3-(2,2-difluoroethoxymethyl)-4-iodo-1-propan-2-ylpyrazole (PubChem CID 122171847) has the molecular formula C9H13F2IN2O and a molecular weight of 330.12 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxymethyl)-4-iodo-1-propan-2-ylpyrazole.
| Compound Name | 3-(2,2-difluoroethoxymethyl)-4-iodo-1-propan-2-ylpyrazole |
|---|---|
| PubChem CID | 122171847 |
| Molecular Formula | C9H13F2IN2O |
| Molecular Weight | 330.12 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 3-(2,2-difluoroethoxymethyl)-4-iodo-1-propan-2-ylpyrazole |
| SMILES | CC(C)n1cc(I)c(COCC(F)F)n1 |
| InChI | InChI=1S/C9H13F2IN2O/c1-6(2)14-3-7(12)8(13-14)4-15-5-9(10)11/h3,6,9H,4-5H2,1-2H3 |
| InChIKey | DNGDTKKMKQOTHT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.12 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|