About CID 122172742
CID 122172742 (PubChem CID 122172742) has the molecular formula C25H29N3O3
and a molecular weight of 419.53 g/mol.
Molecular Properties
| Compound Name | CID 122172742 |
| PubChem CID | 122172742 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | — |
| SMILES | CN1C(=O)C2(NC1N)c1cc(OCC3CC3)ccc1OC21CCc2ccccc2CC1 |
| InChI | InChI=1S/C25H29N3O3/c1-28-22(29)25(27-23(28)26)20-14-19(30-15-16-6-7-16)8-9-21(20)31-24(25)12-10-17-4-2-3-5-18(17)11-13-24/h2-5,8-9,14,16,23,27H,6-7,10-13,15,26H2,1H3 |
| InChIKey | TWHWYAHQBVYGMP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 122172742 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 122172742?
The IUPAC name of CID 122172742 (CID 122172742) is not available.
What is the SMILES notation for CID 122172742?
The canonical SMILES for CID 122172742 is CN1C(=O)C2(NC1N)c1cc(OCC3CC3)ccc1OC21CCc2ccccc2CC1.
What is the InChIKey of CID 122172742?
The InChIKey is TWHWYAHQBVYGMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29N3O3/c1-28-22(29)25(27-23(28)26)20-14-19(30-15-16-6-7-16)8-9-21(20)31-24(25)12-10-17-4-2-3-5-18(17)11-13-24/h2-5,8-9,14,16,23,27H,6-7,10-13,15,26H2,1H3.
What are the key properties of CID 122172742?
CID 122172742 has a molecular weight of 419.53 g/mol, XLogP of 2.68, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 122172742 is sourced from PubChem (CID 122172742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).