C9H5Cl2N3S2 — CID 122172765
5-[(E)-(3,4-dichlorophenyl)methylideneamino]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 122172765) has the molecular formula C9H5Cl2N3S2 and a molecular weight of 290.20 g/mol. Its IUPAC name is 5-[(E)-(3,4-dichlorophenyl)methylideneamino]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[(E)-(3,4-dichlorophenyl)methylideneamino]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 122172765 |
| Molecular Formula | C9H5Cl2N3S2 |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 288.93 |
| IUPAC Name | 5-[(E)-(3,4-dichlorophenyl)methylideneamino]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | S=c1[nH]nc(/N=C/c2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C9H5Cl2N3S2/c10-6-2-1-5(3-7(6)11)4-12-8-13-14-9(15)16-8/h1-4H,(H,14,15)/b12-4+ |
| InChIKey | HPIXMSFOPJQVES-UUILKARUSA-N |
| XLogP | 4.26 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|