C12H13N3O3S2 — CID 122172774
5-[(E)-(2,4,6-trimethoxyphenyl)methylideneamino]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 122172774) has the molecular formula C12H13N3O3S2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 5-[(E)-(2,4,6-trimethoxyphenyl)methylideneamino]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[(E)-(2,4,6-trimethoxyphenyl)methylideneamino]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 122172774 |
| Molecular Formula | C12H13N3O3S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 5-[(E)-(2,4,6-trimethoxyphenyl)methylideneamino]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | COc1cc(OC)c(/C=N/c2n[nH]c(=S)s2)c(OC)c1 |
| InChI | InChI=1S/C12H13N3O3S2/c1-16-7-4-9(17-2)8(10(5-7)18-3)6-13-11-14-15-12(19)20-11/h4-6H,1-3H3,(H,15,19)/b13-6+ |
| InChIKey | QQQQAQAWZQIRAK-AWNIVKPZSA-N |
| XLogP | 2.98 |
| TPSA | 68.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|