C34H42O6SiTe — CID 122173434
Te-phenyl (4S,4aS,8R,8aR)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,6,6-tetramethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine-4-carbotelluroate (PubChem CID 122173434) has the molecular formula C34H42O6SiTe and a molecular weight of 702.39 g/mol. Its IUPAC name is Te-phenyl (4S,4aS,8R,8aR)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,6,6-tetramethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine-4-carbotelluroate.
| Compound Name | Te-phenyl (4S,4aS,8R,8aR)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,6,6-tetramethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine-4-carbotelluroate |
|---|---|
| PubChem CID | 122173434 |
| Molecular Formula | C34H42O6SiTe |
| Molecular Weight | 702.39 g/mol |
| Exact Mass | 704.18 |
| IUPAC Name | Te-phenyl (4S,4aS,8R,8aR)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,6,6-tetramethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine-4-carbotelluroate |
| SMILES | CC1(C)O[C@H]2[C@H](OC(C)(C)O[C@@H]2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](C(=O)[Te]c2ccccc2)O1 |
| InChI | InChI=1S/C34H42O6SiTe/c1-32(2,3)41(24-17-11-8-12-18-24,25-19-13-9-14-20-25)36-23-27-28-29(39-33(4,5)37-27)30(40-34(6,7)38-28)31(35)42-26-21-15-10-16-22-26/h8-22,27-30H,23H2,1-7H3/t27-,28-,29+,30+/m1/s1 |
| InChIKey | HIHKPLZEFYGNMR-XAZDILKDSA-N |
| XLogP | 4.16 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|