About (2R,3S)-3-methyl-2-(methylamino)pentanoic acid;hydrochloride
(2R,3S)-3-methyl-2-(methylamino)pentanoic acid;hydrochloride (PubChem CID 122173693) has the molecular formula C7H16ClNO2
and a molecular weight of 181.66 g/mol. Its IUPAC name is (2R,3S)-3-methyl-2-(methylamino)pentanoic acid;hydrochloride.
Analyze (2R,3S)-3-methyl-2-(methylamino)pentanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-3-methyl-2-(methylamino)pentanoic acid;hydrochloride?
The IUPAC name of (2R,3S)-3-methyl-2-(methylamino)pentanoic acid;hydrochloride (CID 122173693) is (2R,3S)-3-methyl-2-(methylamino)pentanoic acid;hydrochloride.
What is the SMILES notation for (2R,3S)-3-methyl-2-(methylamino)pentanoic acid;hydrochloride?
The canonical SMILES for (2R,3S)-3-methyl-2-(methylamino)pentanoic acid;hydrochloride is CC[C@H](C)[C@@H](NC)C(=O)O.Cl.
What is the InChIKey of (2R,3S)-3-methyl-2-(methylamino)pentanoic acid;hydrochloride?
The InChIKey is MMBGZHHBWVCZFK-RIHPBJNCSA-N. The full InChI is InChI=1S/C7H15NO2.ClH/c1-4-5(2)6(8-3)7(9)10;/h5-6,8H,4H2,1-3H3,(H,9,10);1H/t5-,6+;/m0./s1.
What are the key properties of (2R,3S)-3-methyl-2-(methylamino)pentanoic acid;hydrochloride?
(2R,3S)-3-methyl-2-(methylamino)pentanoic acid;hydrochloride has a molecular weight of 181.66 g/mol, XLogP of 1.13, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-3-methyl-2-(methylamino)pentanoic acid;hydrochloride is sourced from PubChem (CID 122173693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).