C12H22N2 — CID 122174059
(1R,9S)-11-methyl-7,11-diazatricyclo[7.3.1.02,7]tridecane (PubChem CID 122174059) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is (1R,9S)-11-methyl-7,11-diazatricyclo[7.3.1.02,7]tridecane.
| Compound Name | (1R,9S)-11-methyl-7,11-diazatricyclo[7.3.1.02,7]tridecane |
|---|---|
| PubChem CID | 122174059 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | (1R,9S)-11-methyl-7,11-diazatricyclo[7.3.1.02,7]tridecane |
| SMILES | CN1C[C@@H]2C[C@H](C1)C1CCCCN1C2 |
| InChI | InChI=1S/C12H22N2/c1-13-7-10-6-11(9-13)12-4-2-3-5-14(12)8-10/h10-12H,2-9H2,1H3/t10-,11+,12?/m0/s1 |
| InChIKey | JHVZGAIDVLLSEV-WIKAKEFZSA-N |
| XLogP | 1.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |