C29H30N6O — CID 122174293
(4-phenylpiperazin-1-yl)-[1-(4-pyridin-2-ylpiperazin-1-yl)isoquinolin-4-yl]methanone (PubChem CID 122174293) has the molecular formula C29H30N6O and a molecular weight of 478.60 g/mol. Its IUPAC name is (4-phenylpiperazin-1-yl)-[1-(4-pyridin-2-ylpiperazin-1-yl)isoquinolin-4-yl]methanone.
| Compound Name | (4-phenylpiperazin-1-yl)-[1-(4-pyridin-2-ylpiperazin-1-yl)isoquinolin-4-yl]methanone |
|---|---|
| PubChem CID | 122174293 |
| Molecular Formula | C29H30N6O |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | (4-phenylpiperazin-1-yl)-[1-(4-pyridin-2-ylpiperazin-1-yl)isoquinolin-4-yl]methanone |
| SMILES | O=C(c1cnc(N2CCN(c3ccccn3)CC2)c2ccccc12)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C29H30N6O/c36-29(35-20-14-32(15-21-35)23-8-2-1-3-9-23)26-22-31-28(25-11-5-4-10-24(25)26)34-18-16-33(17-19-34)27-12-6-7-13-30-27/h1-13,22H,14-21H2 |
| InChIKey | TWJDRDKRYWVMHR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |