About 3-(2,6-difluorophenyl)-1-(3-morpholin-4-ylpropyl)-1-(pyridin-3-ylmethyl)urea
3-(2,6-difluorophenyl)-1-(3-morpholin-4-ylpropyl)-1-(pyridin-3-ylmethyl)urea (PubChem CID 122176478) has the molecular formula C20H24F2N4O2
and a molecular weight of 390.43 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)-1-(3-morpholin-4-ylpropyl)-1-(pyridin-3-ylmethyl)urea.
Molecular Properties
| Compound Name | 3-(2,6-difluorophenyl)-1-(3-morpholin-4-ylpropyl)-1-(pyridin-3-ylmethyl)urea |
| PubChem CID | 122176478 |
| Molecular Formula | C20H24F2N4O2 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 3-(2,6-difluorophenyl)-1-(3-morpholin-4-ylpropyl)-1-(pyridin-3-ylmethyl)urea |
| SMILES | O=C(Nc1c(F)cccc1F)N(CCCN1CCOCC1)Cc1cccnc1 |
| InChI | InChI=1S/C20H24F2N4O2/c21-17-5-1-6-18(22)19(17)24-20(27)26(15-16-4-2-7-23-14-16)9-3-8-25-10-12-28-13-11-25/h1-2,4-7,14H,3,8-13,15H2,(H,24,27) |
| InChIKey | GPMRYKSGGKCECK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2,6-difluorophenyl)-1-(3-morpholin-4-ylpropyl)-1-(pyridin-3-ylmethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-difluorophenyl)-1-(3-morpholin-4-ylpropyl)-1-(pyridin-3-ylmethyl)urea?
The IUPAC name of 3-(2,6-difluorophenyl)-1-(3-morpholin-4-ylpropyl)-1-(pyridin-3-ylmethyl)urea (CID 122176478) is 3-(2,6-difluorophenyl)-1-(3-morpholin-4-ylpropyl)-1-(pyridin-3-ylmethyl)urea.
What is the SMILES notation for 3-(2,6-difluorophenyl)-1-(3-morpholin-4-ylpropyl)-1-(pyridin-3-ylmethyl)urea?
The canonical SMILES for 3-(2,6-difluorophenyl)-1-(3-morpholin-4-ylpropyl)-1-(pyridin-3-ylmethyl)urea is O=C(Nc1c(F)cccc1F)N(CCCN1CCOCC1)Cc1cccnc1.
What is the InChIKey of 3-(2,6-difluorophenyl)-1-(3-morpholin-4-ylpropyl)-1-(pyridin-3-ylmethyl)urea?
The InChIKey is GPMRYKSGGKCECK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24F2N4O2/c21-17-5-1-6-18(22)19(17)24-20(27)26(15-16-4-2-7-23-14-16)9-3-8-25-10-12-28-13-11-25/h1-2,4-7,14H,3,8-13,15H2,(H,24,27).
What are the key properties of 3-(2,6-difluorophenyl)-1-(3-morpholin-4-ylpropyl)-1-(pyridin-3-ylmethyl)urea?
3-(2,6-difluorophenyl)-1-(3-morpholin-4-ylpropyl)-1-(pyridin-3-ylmethyl)urea has a molecular weight of 390.43 g/mol, XLogP of 3.12, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-difluorophenyl)-1-(3-morpholin-4-ylpropyl)-1-(pyridin-3-ylmethyl)urea is sourced from PubChem (CID 122176478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).