C7H8BO3- — CID 122177116
7,7-dihydroxy-8-oxa-7-boranuidabicyclo[4.3.0]nona-1,3,5-triene (PubChem CID 122177116) has the molecular formula C7H8BO3- and a molecular weight of 150.95 g/mol. Its IUPAC name is 7,7-dihydroxy-8-oxa-7-boranuidabicyclo[4.3.0]nona-1,3,5-triene.
| Compound Name | 7,7-dihydroxy-8-oxa-7-boranuidabicyclo[4.3.0]nona-1,3,5-triene |
|---|---|
| PubChem CID | 122177116 |
| Molecular Formula | C7H8BO3- |
| Molecular Weight | 150.95 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 7,7-dihydroxy-8-oxa-7-boranuidabicyclo[4.3.0]nona-1,3,5-triene |
| SMILES | O[B-]1(O)OCc2ccccc21 |
| InChI | InChI=1S/C7H8BO3/c9-8(10)7-4-2-1-3-6(7)5-11-8/h1-4,9-10H,5H2/q-1 |
| InChIKey | LFYLOXDIRWAWMG-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.95 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|