C20H22N2O3 — CID 122177269
1-(4,5-dihydro-1,2-oxazol-3-yl)-1-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-N-methoxymethanimine (PubChem CID 122177269) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-(4,5-dihydro-1,2-oxazol-3-yl)-1-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-N-methoxymethanimine.
| Compound Name | 1-(4,5-dihydro-1,2-oxazol-3-yl)-1-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-N-methoxymethanimine |
|---|---|
| PubChem CID | 122177269 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-(4,5-dihydro-1,2-oxazol-3-yl)-1-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-N-methoxymethanimine |
| SMILES | CON=C(C1=NOCC1)c1ccccc1COc1cc(C)ccc1C |
| InChI | InChI=1S/C20H22N2O3/c1-14-8-9-15(2)19(12-14)24-13-16-6-4-5-7-17(16)20(22-23-3)18-10-11-25-21-18/h4-9,12H,10-11,13H2,1-3H3 |
| InChIKey | FFGZDIZABIWTSP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|