C27H47N7O5 — CID 122177299
(2S)-6-amino-2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-(4-aminophenyl)propanoyl]amino]hexanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid (PubChem CID 122177299) has the molecular formula C27H47N7O5 and a molecular weight of 549.72 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-(4-aminophenyl)propanoyl]amino]hexanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-(4-aminophenyl)propanoyl]amino]hexanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 122177299 |
| Molecular Formula | C27H47N7O5 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.36 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-(4-aminophenyl)propanoyl]amino]hexanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)Cc1ccc(N)cc1)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C27H47N7O5/c1-17(2)15-23(26(37)33-22(27(38)39)8-4-6-14-29)34-25(36)21(7-3-5-13-28)32-24(35)20(31)16-18-9-11-19(30)12-10-18/h9-12,17,20-23H,3-8,13-16,28-31H2,1-2H3,(H,32,35)(H,33,37)(H,34,36)(H,38,39)/t20-,21-,22-,23-/m0/s1 |
| InChIKey | PJRSFAQYDJPUHW-MLCQCVOFSA-N |
| XLogP | -0.02 |
| TPSA | 228.68 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|