C22H34O4 — CID 122177326
(1R,3R,6R,10R,12S,13S)-3-ethyl-13,17-dihydroxy-4,6,10,12-tetramethyl-16-oxatricyclo[12.2.1.01,6]heptadeca-4,14(17)-dien-15-one (PubChem CID 122177326) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is (1R,3R,6R,10R,12S,13S)-3-ethyl-13,17-dihydroxy-4,6,10,12-tetramethyl-16-oxatricyclo[12.2.1.01,6]heptadeca-4,14(17)-dien-15-one.
| Compound Name | (1R,3R,6R,10R,12S,13S)-3-ethyl-13,17-dihydroxy-4,6,10,12-tetramethyl-16-oxatricyclo[12.2.1.01,6]heptadeca-4,14(17)-dien-15-one |
|---|---|
| PubChem CID | 122177326 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (1R,3R,6R,10R,12S,13S)-3-ethyl-13,17-dihydroxy-4,6,10,12-tetramethyl-16-oxatricyclo[12.2.1.01,6]heptadeca-4,14(17)-dien-15-one |
| SMILES | CC[C@@H]1C[C@]23OC(=O)C(=C2O)[C@@H](O)[C@@H](C)C[C@H](C)CCC[C@]3(C)C=C1C |
| InChI | InChI=1S/C22H34O4/c1-6-16-12-22-19(24)17(20(25)26-22)18(23)14(3)10-13(2)8-7-9-21(22,5)11-15(16)4/h11,13-14,16,18,23-24H,6-10,12H2,1-5H3/t13-,14+,16-,18+,21-,22+/m1/s1 |
| InChIKey | YNFLDFCGSWUJDT-MREMGJDTSA-N |
| XLogP | 4.68 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|