C17H10F6N2O — CID 122177406
(1E,4E)-1,5-bis[6-(trifluoromethyl)-3-pyridinyl]penta-1,4-dien-3-one (PubChem CID 122177406) has the molecular formula C17H10F6N2O and a molecular weight of 372.27 g/mol. Its IUPAC name is (1E,4E)-1,5-bis[6-(trifluoromethyl)-3-pyridinyl]penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1,5-bis[6-(trifluoromethyl)-3-pyridinyl]penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 122177406 |
| Molecular Formula | C17H10F6N2O |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | (1E,4E)-1,5-bis[6-(trifluoromethyl)-3-pyridinyl]penta-1,4-dien-3-one |
| SMILES | O=C(/C=C/c1ccc(C(F)(F)F)nc1)/C=C/c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C17H10F6N2O/c18-16(19,20)14-7-3-11(9-24-14)1-5-13(26)6-2-12-4-8-15(25-10-12)17(21,22)23/h1-10H/b5-1+,6-2+ |
| InChIKey | VKIXNZJCPLTHQG-IJIVKGSJSA-N |
| XLogP | 4.81 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|