C15H26O3 — CID 122177431
(1S,2R,3R,5E,7R,10S)-2,6,9,9-tetramethylbicyclo[8.1.0]undec-5-ene-2,3,7-triol (PubChem CID 122177431) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (1S,2R,3R,5E,7R,10S)-2,6,9,9-tetramethylbicyclo[8.1.0]undec-5-ene-2,3,7-triol.
| Compound Name | (1S,2R,3R,5E,7R,10S)-2,6,9,9-tetramethylbicyclo[8.1.0]undec-5-ene-2,3,7-triol |
|---|---|
| PubChem CID | 122177431 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (1S,2R,3R,5E,7R,10S)-2,6,9,9-tetramethylbicyclo[8.1.0]undec-5-ene-2,3,7-triol |
| SMILES | C/C1=C\C[C@@H](O)[C@](C)(O)[C@H]2C[C@@H]2C(C)(C)C[C@H]1O |
| InChI | InChI=1S/C15H26O3/c1-9-5-6-13(17)15(4,18)11-7-10(11)14(2,3)8-12(9)16/h5,10-13,16-18H,6-8H2,1-4H3/b9-5+/t10-,11-,12+,13+,15+/m0/s1 |
| InChIKey | PVBJZOCDVNCPLR-PAPWEDSUSA-N |
| XLogP | 1.86 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|