C33H42N4O — CID 122177472
(1E,4E)-1,5-bis(1-heptylbenzimidazol-2-yl)penta-1,4-dien-3-one (PubChem CID 122177472) has the molecular formula C33H42N4O and a molecular weight of 510.73 g/mol. Its IUPAC name is (1E,4E)-1,5-bis(1-heptylbenzimidazol-2-yl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1,5-bis(1-heptylbenzimidazol-2-yl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 122177472 |
| Molecular Formula | C33H42N4O |
| Molecular Weight | 510.73 g/mol |
| Exact Mass | 510.34 |
| IUPAC Name | (1E,4E)-1,5-bis(1-heptylbenzimidazol-2-yl)penta-1,4-dien-3-one |
| SMILES | CCCCCCCn1c(/C=C/C(=O)/C=C/c2nc3ccccc3n2CCCCCCC)nc2ccccc21 |
| InChI | InChI=1S/C33H42N4O/c1-3-5-7-9-15-25-36-30-19-13-11-17-28(30)34-32(36)23-21-27(38)22-24-33-35-29-18-12-14-20-31(29)37(33)26-16-10-8-6-4-2/h11-14,17-24H,3-10,15-16,25-26H2,1-2H3/b23-21+,24-22+ |
| InChIKey | AGBGNGXJVTZAPY-MBALSZOMSA-N |
| XLogP | 8.62 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.73 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|