C29H34N4O — CID 122177476
(1E,4E)-1,5-bis[1-(3-methylbutyl)benzimidazol-2-yl]penta-1,4-dien-3-one (PubChem CID 122177476) has the molecular formula C29H34N4O and a molecular weight of 454.62 g/mol. Its IUPAC name is (1E,4E)-1,5-bis[1-(3-methylbutyl)benzimidazol-2-yl]penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1,5-bis[1-(3-methylbutyl)benzimidazol-2-yl]penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 122177476 |
| Molecular Formula | C29H34N4O |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | (1E,4E)-1,5-bis[1-(3-methylbutyl)benzimidazol-2-yl]penta-1,4-dien-3-one |
| SMILES | CC(C)CCn1c(/C=C/C(=O)/C=C/c2nc3ccccc3n2CCC(C)C)nc2ccccc21 |
| InChI | InChI=1S/C29H34N4O/c1-21(2)17-19-32-26-11-7-5-9-24(26)30-28(32)15-13-23(34)14-16-29-31-25-10-6-8-12-27(25)33(29)20-18-22(3)4/h5-16,21-22H,17-20H2,1-4H3/b15-13+,16-14+ |
| InChIKey | ONJISIUHRYAPMS-WXUKJITCSA-N |
| XLogP | 6.77 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|